C23H15ClF3N3O4S — CID 167198789
2-(1-chloroisoquinolin-4-yl)oxy-N-(3-methylsulfonylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 167198789) has the molecular formula C23H15ClF3N3O4S and a molecular weight of 521.90 g/mol. Its IUPAC name is 2-(1-chloroisoquinolin-4-yl)oxy-N-(3-methylsulfonylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(1-chloroisoquinolin-4-yl)oxy-N-(3-methylsulfonylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167198789 |
| Molecular Formula | C23H15ClF3N3O4S |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 2-(1-chloroisoquinolin-4-yl)oxy-N-(3-methylsulfonylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2cc(C(F)(F)F)cnc2Oc2cnc(Cl)c3ccccc23)c1 |
| InChI | InChI=1S/C23H15ClF3N3O4S/c1-35(32,33)15-6-4-5-14(10-15)30-21(31)18-9-13(23(25,26)27)11-29-22(18)34-19-12-28-20(24)17-8-3-2-7-16(17)19/h2-12H,1H3,(H,30,31) |
| InChIKey | DZIGEWHADCPZOA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|