C19H13ClF3N3O4 — CID 151322450
2-(2-chloro-4-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 151322450) has the molecular formula C19H13ClF3N3O4 and a molecular weight of 439.78 g/mol. Its IUPAC name is 2-(2-chloro-4-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-chloro-4-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 151322450 |
| Molecular Formula | C19H13ClF3N3O4 |
| Molecular Weight | 439.78 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-(2-chloro-4-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(Oc2ncc(C(F)(F)F)cc2C(=O)Nc2ccc[n+]([O-])c2)c(Cl)c1 |
| InChI | InChI=1S/C19H13ClF3N3O4/c1-29-13-4-5-16(15(20)8-13)30-18-14(7-11(9-24-18)19(21,22)23)17(27)25-12-3-2-6-26(28)10-12/h2-10H,1H3,(H,25,27) |
| InChIKey | OGTBYUOELSQXPJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|