C20H14F6N3O5+ — CID 170241955
N-(1-hydroxypyridin-1-ium-3-yl)-2-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 170241955) has the molecular formula C20H14F6N3O5+ and a molecular weight of 490.34 g/mol. Its IUPAC name is N-(1-hydroxypyridin-1-ium-3-yl)-2-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(1-hydroxypyridin-1-ium-3-yl)-2-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170241955 |
| Molecular Formula | C20H14F6N3O5+ |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | N-(1-hydroxypyridin-1-ium-3-yl)-2-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COc1cc(OC(F)(F)F)ccc1Oc1ncc(C(F)(F)F)cc1C(=O)Nc1ccc[n+](O)c1 |
| InChI | InChI=1S/C20H13F6N3O5/c1-32-16-8-13(34-20(24,25)26)4-5-15(16)33-18-14(7-11(9-27-18)19(21,22)23)17(30)28-12-3-2-6-29(31)10-12/h2-10H,1H3,(H-,28,30,31)/p+1 |
| InChIKey | HVPGMABEOPEYNC-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|