C20H13F3N4O4 — CID 170650153
2-(4-cyano-2-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 170650153) has the molecular formula C20H13F3N4O4 and a molecular weight of 430.34 g/mol. Its IUPAC name is 2-(4-cyano-2-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(4-cyano-2-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170650153 |
| Molecular Formula | C20H13F3N4O4 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-(4-cyano-2-methoxyphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COc1cc(C#N)ccc1Oc1ncc(C(F)(F)F)cc1C(=O)Nc1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C20H13F3N4O4/c1-30-17-7-12(9-24)4-5-16(17)31-19-15(8-13(10-25-19)20(21,22)23)18(28)26-14-3-2-6-27(29)11-14/h2-8,10-11H,1H3,(H,26,28) |
| InChIKey | IRDJOBNCOUNRIR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|