C17H11F4N5O3 — CID 177358169
2-(2-amino-4-fluorophenoxy)-N-(6-oxo-1H-pyridazin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 177358169) has the molecular formula C17H11F4N5O3 and a molecular weight of 409.30 g/mol. Its IUPAC name is 2-(2-amino-4-fluorophenoxy)-N-(6-oxo-1H-pyridazin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-amino-4-fluorophenoxy)-N-(6-oxo-1H-pyridazin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177358169 |
| Molecular Formula | C17H11F4N5O3 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-(2-amino-4-fluorophenoxy)-N-(6-oxo-1H-pyridazin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Nc1cc(F)ccc1Oc1ncc(C(F)(F)F)cc1C(=O)Nc1cn[nH]c(=O)c1 |
| InChI | InChI=1S/C17H11F4N5O3/c18-9-1-2-13(12(22)4-9)29-16-11(3-8(6-23-16)17(19,20)21)15(28)25-10-5-14(27)26-24-7-10/h1-7H,22H2,(H2,25,26,27,28) |
| InChIKey | DOXMRJRWGKVGSE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|