C22H20F4N4O4 — CID 177357924
2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 177357924) has the molecular formula C22H20F4N4O4 and a molecular weight of 480.42 g/mol. Its IUPAC name is 2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177357924 |
| Molecular Formula | C22H20F4N4O4 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CNCCCOc1cc(F)ccc1Oc1ncc(C(F)(F)F)cc1C(=O)Nc1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C22H20F4N4O4/c1-27-6-2-8-33-18-10-14(23)3-4-17(18)34-21-16(9-13(12-29-21)22(24,25)26)20(32)30-15-5-7-28-19(31)11-15/h3-5,7,9-12,27H,2,6,8H2,1H3,(H2,28,30,31,32) |
| InChIKey | HYBGQKKECCRVFF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|