C17H14F6N2O3 — CID 90302339
N-(2-oxo-1H-pyridin-4-yl)-2-(4,4,4-trifluorobutoxy)-5-(trifluoromethyl)benzamide (PubChem CID 90302339) has the molecular formula C17H14F6N2O3 and a molecular weight of 408.30 g/mol. Its IUPAC name is N-(2-oxo-1H-pyridin-4-yl)-2-(4,4,4-trifluorobutoxy)-5-(trifluoromethyl)benzamide.
| Compound Name | N-(2-oxo-1H-pyridin-4-yl)-2-(4,4,4-trifluorobutoxy)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90302339 |
| Molecular Formula | C17H14F6N2O3 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-(2-oxo-1H-pyridin-4-yl)-2-(4,4,4-trifluorobutoxy)-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cc[nH]c(=O)c1)c1cc(C(F)(F)F)ccc1OCCCC(F)(F)F |
| InChI | InChI=1S/C17H14F6N2O3/c18-16(19,20)5-1-7-28-13-3-2-10(17(21,22)23)8-12(13)15(27)25-11-4-6-24-14(26)9-11/h2-4,6,8-9H,1,5,7H2,(H2,24,25,26,27) |
| InChIKey | QGRSBMGQNLDEPE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|