C23H21F4N3O3S — CID 177358066
2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(3-sulfanylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 177358066) has the molecular formula C23H21F4N3O3S and a molecular weight of 495.50 g/mol. Its IUPAC name is 2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(3-sulfanylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(3-sulfanylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177358066 |
| Molecular Formula | C23H21F4N3O3S |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-[4-fluoro-2-[3-(methylamino)propoxy]phenoxy]-N-(3-sulfanylphenyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CNCCCOc1cc(F)ccc1Oc1ncc(C(F)(F)F)cc1C(=O)Nc1cccc(S)c1 |
| InChI | InChI=1S/C23H21F4N3O3S/c1-28-8-3-9-32-20-11-15(24)6-7-19(20)33-22-18(10-14(13-29-22)23(25,26)27)21(31)30-16-4-2-5-17(34)12-16/h2,4-7,10-13,28,34H,3,8-9H2,1H3,(H,30,31) |
| InChIKey | UHPITAMWTICWHT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|