C23H21F4N3O6S — CID 163361501
2-[4-fluoro-2-[2-(methanesulfonamido)ethoxy]phenoxy]-N-(2-methoxy-4-pyridinyl)-4-(trifluoromethyl)benzamide (PubChem CID 163361501) has the molecular formula C23H21F4N3O6S and a molecular weight of 543.50 g/mol. Its IUPAC name is 2-[4-fluoro-2-[2-(methanesulfonamido)ethoxy]phenoxy]-N-(2-methoxy-4-pyridinyl)-4-(trifluoromethyl)benzamide.
| Compound Name | 2-[4-fluoro-2-[2-(methanesulfonamido)ethoxy]phenoxy]-N-(2-methoxy-4-pyridinyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163361501 |
| Molecular Formula | C23H21F4N3O6S |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-[4-fluoro-2-[2-(methanesulfonamido)ethoxy]phenoxy]-N-(2-methoxy-4-pyridinyl)-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(C(F)(F)F)cc2Oc2ccc(F)cc2OCCNS(C)(=O)=O)ccn1 |
| InChI | InChI=1S/C23H21F4N3O6S/c1-34-21-13-16(7-8-28-21)30-22(31)17-5-3-14(23(25,26)27)11-19(17)36-18-6-4-15(24)12-20(18)35-10-9-29-37(2,32)33/h3-8,11-13,29H,9-10H2,1-2H3,(H,28,30,31) |
| InChIKey | USEVVAJJVGISEG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|