C21H16F4N2O5S — CID 90467902
2-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)-4-(trifluoromethyl)benzamide (PubChem CID 90467902) has the molecular formula C21H16F4N2O5S and a molecular weight of 484.43 g/mol. Its IUPAC name is 2-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)-4-(trifluoromethyl)benzamide.
| Compound Name | 2-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90467902 |
| Molecular Formula | C21H16F4N2O5S |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 2-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(F)ccc1Oc1cc(C(F)(F)F)ccc1C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C21H16F4N2O5S/c1-31-19-10-13(22)6-8-17(19)32-18-9-12(21(23,24)25)5-7-16(18)20(28)27-14-3-2-4-15(11-14)33(26,29)30/h2-11H,1H3,(H,27,28)(H2,26,29,30) |
| InChIKey | XLYVFIXMSCHNNX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |