C22H16ClF5N2O5S — CID 90466907
2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-N-(3-sulfamoylphenyl)benzamide (PubChem CID 90466907) has the molecular formula C22H16ClF5N2O5S and a molecular weight of 550.89 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 90466907 |
| Molecular Formula | C22H16ClF5N2O5S |
| Molecular Weight | 550.89 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-N-(3-sulfamoylphenyl)benzamide |
| SMILES | COc1cc(Cl)ccc1Oc1cc(C(F)(F)C(F)(F)F)ccc1C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C22H16ClF5N2O5S/c1-34-19-10-13(23)6-8-17(19)35-18-9-12(21(24,25)22(26,27)28)5-7-16(18)20(31)30-14-3-2-4-15(11-14)36(29,32)33/h2-11H,1H3,(H,30,31)(H2,29,32,33) |
| InChIKey | VAPWRNSRKCNYAG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|