C24H27N3O4S — CID 58988094
4-tert-butyl-2-[(2,6-dimethyl-4-pyridinyl)oxy]-N-(3-sulfamoylphenyl)benzamide (PubChem CID 58988094) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-tert-butyl-2-[(2,6-dimethyl-4-pyridinyl)oxy]-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 4-tert-butyl-2-[(2,6-dimethyl-4-pyridinyl)oxy]-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 58988094 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-tert-butyl-2-[(2,6-dimethyl-4-pyridinyl)oxy]-N-(3-sulfamoylphenyl)benzamide |
| SMILES | Cc1cc(Oc2cc(C(C)(C)C)ccc2C(=O)Nc2cccc(S(N)(=O)=O)c2)cc(C)n1 |
| InChI | InChI=1S/C24H27N3O4S/c1-15-11-19(12-16(2)26-15)31-22-13-17(24(3,4)5)9-10-21(22)23(28)27-18-7-6-8-20(14-18)32(25,29)30/h6-14H,1-5H3,(H,27,28)(H2,25,29,30) |
| InChIKey | ZTTRMQYXRJJWFM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |