C13H16N4O3S2 — CID 25263014
5-tert-butyl-N-(3-sulfamoylphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 25263014) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-tert-butyl-N-(3-sulfamoylphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-tert-butyl-N-(3-sulfamoylphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 25263014 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 5-tert-butyl-N-(3-sulfamoylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CC(C)(C)c1nnc(C(=O)Nc2cccc(S(N)(=O)=O)c2)s1 |
| InChI | InChI=1S/C13H16N4O3S2/c1-13(2,3)12-17-16-11(21-12)10(18)15-8-5-4-6-9(7-8)22(14,19)20/h4-7H,1-3H3,(H,15,18)(H2,14,19,20) |
| InChIKey | PBRRTRPXGMMIPD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |