C11H12N4O3S2 — CID 60692504
4-ethyl-N-(3-sulfamoylphenyl)thiadiazole-5-carboxamide (PubChem CID 60692504) has the molecular formula C11H12N4O3S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-ethyl-N-(3-sulfamoylphenyl)thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-(3-sulfamoylphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 60692504 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-ethyl-N-(3-sulfamoylphenyl)thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H12N4O3S2/c1-2-9-10(19-15-14-9)11(16)13-7-4-3-5-8(6-7)20(12,17)18/h3-6H,2H2,1H3,(H,13,16)(H2,12,17,18) |
| InChIKey | PIXBLSGKZRPMAY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |