C12H10N4OS2 — CID 99825241
N-(1,2-benzothiazol-5-yl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 99825241) has the molecular formula C12H10N4OS2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-(1,2-benzothiazol-5-yl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(1,2-benzothiazol-5-yl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 99825241 |
| Molecular Formula | C12H10N4OS2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | N-(1,2-benzothiazol-5-yl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccc2sncc2c1 |
| InChI | InChI=1S/C12H10N4OS2/c1-2-9-11(19-16-15-9)12(17)14-8-3-4-10-7(5-8)6-13-18-10/h3-6H,2H2,1H3,(H,14,17) |
| InChIKey | MRDKOWWKWCJNRC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |