C10H11N5OS — CID 65210585
N-(6-amino-3-pyridinyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 65210585) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(6-amino-3-pyridinyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65210585 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccc(N)nc1 |
| InChI | InChI=1S/C10H11N5OS/c1-2-7-9(17-15-14-7)10(16)13-6-3-4-8(11)12-5-6/h3-5H,2H2,1H3,(H2,11,12)(H,13,16) |
| InChIKey | AXYZCKQMDMNXCM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |