C11H13N5OS — CID 112555384
N-(5-amino-3-methyl-2-pyridinyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 112555384) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is N-(5-amino-3-methyl-2-pyridinyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(5-amino-3-methyl-2-pyridinyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 112555384 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-(5-amino-3-methyl-2-pyridinyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ncc(N)cc1C |
| InChI | InChI=1S/C11H13N5OS/c1-3-8-9(18-16-15-8)11(17)14-10-6(2)4-7(12)5-13-10/h4-5H,3,12H2,1-2H3,(H,13,14,17) |
| InChIKey | NMPIFINDJHJQFK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |