C11H10Br2N4OS — CID 65206158
N-(2-amino-4,6-dibromophenyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 65206158) has the molecular formula C11H10Br2N4OS and a molecular weight of 406.10 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65206158 |
| Molecular Formula | C11H10Br2N4OS |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C11H10Br2N4OS/c1-2-8-10(19-17-16-8)11(18)15-9-6(13)3-5(12)4-7(9)14/h3-4H,2,14H2,1H3,(H,15,18) |
| InChIKey | BGKOLYHUTOCZFW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|