C11H11BrN4O3S2 — CID 65210041
N-(2-bromo-4-sulfamoylphenyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 65210041) has the molecular formula C11H11BrN4O3S2 and a molecular weight of 391.27 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65210041 |
| Molecular Formula | C11H11BrN4O3S2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccc(S(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C11H11BrN4O3S2/c1-2-8-10(20-16-15-8)11(17)14-9-4-3-6(5-7(9)12)21(13,18)19/h3-5H,2H2,1H3,(H,14,17)(H2,13,18,19) |
| InChIKey | YQLAOUMVTAFZHL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |