C12H14N4O3S2 — CID 25331555
4-ethyl-N-[2-(methanesulfonamido)phenyl]thiadiazole-5-carboxamide (PubChem CID 25331555) has the molecular formula C12H14N4O3S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-ethyl-N-[2-(methanesulfonamido)phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[2-(methanesulfonamido)phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 25331555 |
| Molecular Formula | C12H14N4O3S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-ethyl-N-[2-(methanesulfonamido)phenyl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C12H14N4O3S2/c1-3-8-11(20-16-14-8)12(17)13-9-6-4-5-7-10(9)15-21(2,18)19/h4-7,15H,3H2,1-2H3,(H,13,17) |
| InChIKey | GEIUROOOCBLQBR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |