C12H10ClN3O3S — CID 65206218
4-chloro-3-[(4-ethylthiadiazole-5-carbonyl)amino]benzoic acid (PubChem CID 65206218) has the molecular formula C12H10ClN3O3S and a molecular weight of 311.75 g/mol. Its IUPAC name is 4-chloro-3-[(4-ethylthiadiazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 4-chloro-3-[(4-ethylthiadiazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 65206218 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-chloro-3-[(4-ethylthiadiazole-5-carbonyl)amino]benzoic acid |
| SMILES | CCc1nnsc1C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C12H10ClN3O3S/c1-2-8-10(20-16-15-8)11(17)14-9-5-6(12(18)19)3-4-7(9)13/h3-5H,2H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | LFEYKFFVCUZSJW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |