C15H14N6O3S2 — CID 18584570
4-ethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiadiazole-5-carboxamide (PubChem CID 18584570) has the molecular formula C15H14N6O3S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 4-ethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 18584570 |
| Molecular Formula | C15H14N6O3S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 4-ethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C15H14N6O3S2/c1-2-12-13(25-21-19-12)14(22)18-10-4-6-11(7-5-10)26(23,24)20-15-16-8-3-9-17-15/h3-9H,2H2,1H3,(H,18,22)(H,16,17,20) |
| InChIKey | JEJPGDHJOUNUPT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |