C14H18N4O4S2 — CID 9192852
N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 9192852) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 9192852 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1OC |
| InChI | InChI=1S/C14H18N4O4S2/c1-5-10-13(23-17-16-10)14(19)15-11-8-9(6-7-12(11)22-4)24(20,21)18(2)3/h6-8H,5H2,1-4H3,(H,15,19) |
| InChIKey | IJQUWOMXPXRUDT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |