C12H11BrN2O4S2 — CID 81119012
N-(2-bromo-4-sulfamoylphenyl)-3-methoxythiophene-2-carboxamide (PubChem CID 81119012) has the molecular formula C12H11BrN2O4S2 and a molecular weight of 391.27 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)-3-methoxythiophene-2-carboxamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)-3-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 81119012 |
| Molecular Formula | C12H11BrN2O4S2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)-3-methoxythiophene-2-carboxamide |
| SMILES | COc1ccsc1C(=O)Nc1ccc(S(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C12H11BrN2O4S2/c1-19-10-4-5-20-11(10)12(16)15-9-3-2-7(6-8(9)13)21(14,17)18/h2-6H,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | ZBQARJOEGBNXEZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |