C12H8BrF2NO2S — CID 113330149
N-(4-bromo-2,5-difluorophenyl)-3-methoxythiophene-2-carboxamide (PubChem CID 113330149) has the molecular formula C12H8BrF2NO2S and a molecular weight of 348.17 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-3-methoxythiophene-2-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-3-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 113330149 |
| Molecular Formula | C12H8BrF2NO2S |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-3-methoxythiophene-2-carboxamide |
| SMILES | COc1ccsc1C(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H8BrF2NO2S/c1-18-10-2-3-19-11(10)12(17)16-9-5-7(14)6(13)4-8(9)15/h2-5H,1H3,(H,16,17) |
| InChIKey | WJFBUWQDKYWHHK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|