C20H20N4O4S — CID 55865042
4-ethyl-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]thiadiazole-5-carboxamide (PubChem CID 55865042) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 4-ethyl-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 55865042 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-ethyl-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1cccc(NC(=O)COc2ccccc2OC)c1 |
| InChI | InChI=1S/C20H20N4O4S/c1-3-15-19(29-24-23-15)20(26)22-14-8-6-7-13(11-14)21-18(25)12-28-17-10-5-4-9-16(17)27-2/h4-11H,3,12H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | OQSBKHSZQXQQLR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |