C13H14N2O3S2 — CID 78969242
3-ethyl-N-(3-sulfamoylphenyl)thiophene-2-carboxamide (PubChem CID 78969242) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-ethyl-N-(3-sulfamoylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-ethyl-N-(3-sulfamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78969242 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 3-ethyl-N-(3-sulfamoylphenyl)thiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-2-9-6-7-19-12(9)13(16)15-10-4-3-5-11(8-10)20(14,17)18/h3-8H,2H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | BARNQWHBBKCTJK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |