C20H15Cl2FN2O5S — CID 90467489
2,4-dichloro-6-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)benzamide (PubChem CID 90467489) has the molecular formula C20H15Cl2FN2O5S and a molecular weight of 485.32 g/mol. Its IUPAC name is 2,4-dichloro-6-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 2,4-dichloro-6-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 90467489 |
| Molecular Formula | C20H15Cl2FN2O5S |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 2,4-dichloro-6-(4-fluoro-2-methoxyphenoxy)-N-(3-sulfamoylphenyl)benzamide |
| SMILES | COc1cc(F)ccc1Oc1cc(Cl)cc(Cl)c1C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H15Cl2FN2O5S/c1-29-17-9-12(23)5-6-16(17)30-18-8-11(21)7-15(22)19(18)20(26)25-13-3-2-4-14(10-13)31(24,27)28/h2-10H,1H3,(H,25,26)(H2,24,27,28) |
| InChIKey | BMIVUIPFPAOHMC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |