C21H14F2N4O4S — CID 78319770
3-(2,4-difluorophenoxy)-N-(3-sulfamoylphenyl)quinoxaline-2-carboxamide (PubChem CID 78319770) has the molecular formula C21H14F2N4O4S and a molecular weight of 456.43 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)-N-(3-sulfamoylphenyl)quinoxaline-2-carboxamide.
| Compound Name | 3-(2,4-difluorophenoxy)-N-(3-sulfamoylphenyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 78319770 |
| Molecular Formula | C21H14F2N4O4S |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 3-(2,4-difluorophenoxy)-N-(3-sulfamoylphenyl)quinoxaline-2-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2nc3ccccc3nc2Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C21H14F2N4O4S/c22-12-8-9-18(15(23)10-12)31-21-19(26-16-6-1-2-7-17(16)27-21)20(28)25-13-4-3-5-14(11-13)32(24,29)30/h1-11H,(H,25,28)(H2,24,29,30) |
| InChIKey | JPNNYEVGDPYVAC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |