C21H14F2N4O3S — CID 144678750
3-(2,4-difluorophenoxy)-N-(3-sulfinamoylphenyl)quinoxaline-2-carboxamide (PubChem CID 144678750) has the molecular formula C21H14F2N4O3S and a molecular weight of 440.43 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)-N-(3-sulfinamoylphenyl)quinoxaline-2-carboxamide.
| Compound Name | 3-(2,4-difluorophenoxy)-N-(3-sulfinamoylphenyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 144678750 |
| Molecular Formula | C21H14F2N4O3S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 3-(2,4-difluorophenoxy)-N-(3-sulfinamoylphenyl)quinoxaline-2-carboxamide |
| SMILES | NS(=O)c1cccc(NC(=O)c2nc3ccccc3nc2Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C21H14F2N4O3S/c22-12-8-9-18(15(23)10-12)30-21-19(26-16-6-1-2-7-17(16)27-21)20(28)25-13-4-3-5-14(11-13)31(24)29/h1-11H,24H2,(H,25,28) |
| InChIKey | ZNTQCKLMXHYWOO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |