C21H12Cl2F2N4O4S — CID 118522061
3-(2-chloro-4-fluorophenoxy)-N-[3-chloro-4-(fluorosulfamoyl)phenyl]quinoxaline-2-carboxamide (PubChem CID 118522061) has the molecular formula C21H12Cl2F2N4O4S and a molecular weight of 525.32 g/mol. Its IUPAC name is 3-(2-chloro-4-fluorophenoxy)-N-[3-chloro-4-(fluorosulfamoyl)phenyl]quinoxaline-2-carboxamide.
| Compound Name | 3-(2-chloro-4-fluorophenoxy)-N-[3-chloro-4-(fluorosulfamoyl)phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 118522061 |
| Molecular Formula | C21H12Cl2F2N4O4S |
| Molecular Weight | 525.32 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | 3-(2-chloro-4-fluorophenoxy)-N-[3-chloro-4-(fluorosulfamoyl)phenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NF)c(Cl)c1)c1nc2ccccc2nc1Oc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H12Cl2F2N4O4S/c22-13-9-11(24)5-7-17(13)33-21-19(27-15-3-1-2-4-16(15)28-21)20(30)26-12-6-8-18(14(23)10-12)34(31,32)29-25/h1-10,29H,(H,26,30) |
| InChIKey | RGUAWZZEBATETO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.32 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|