C23H15FN4O3 — CID 118376009
N-(4-ethynyl-2-pyridinyl)-3-(4-fluoro-2-methoxyphenoxy)quinoxaline-2-carboxamide (PubChem CID 118376009) has the molecular formula C23H15FN4O3 and a molecular weight of 414.40 g/mol. Its IUPAC name is N-(4-ethynyl-2-pyridinyl)-3-(4-fluoro-2-methoxyphenoxy)quinoxaline-2-carboxamide.
| Compound Name | N-(4-ethynyl-2-pyridinyl)-3-(4-fluoro-2-methoxyphenoxy)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 118376009 |
| Molecular Formula | C23H15FN4O3 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-(4-ethynyl-2-pyridinyl)-3-(4-fluoro-2-methoxyphenoxy)quinoxaline-2-carboxamide |
| SMILES | C#Cc1ccnc(NC(=O)c2nc3ccccc3nc2Oc2ccc(F)cc2OC)c1 |
| InChI | InChI=1S/C23H15FN4O3/c1-3-14-10-11-25-20(12-14)28-22(29)21-23(27-17-7-5-4-6-16(17)26-21)31-18-9-8-15(24)13-19(18)30-2/h1,4-13H,2H3,(H,25,28,29) |
| InChIKey | IHNYNKSBHGWFFV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|