C17H14ClN3O2 — CID 50780737
N-(3-chlorophenyl)-3-ethoxyquinoxaline-2-carboxamide (PubChem CID 50780737) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-ethoxyquinoxaline-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-ethoxyquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 50780737 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(3-chlorophenyl)-3-ethoxyquinoxaline-2-carboxamide |
| SMILES | CCOc1nc2ccccc2nc1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14ClN3O2/c1-2-23-17-15(20-13-8-3-4-9-14(13)21-17)16(22)19-12-7-5-6-11(18)10-12/h3-10H,2H2,1H3,(H,19,22) |
| InChIKey | RLDHADFUAWIZJI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |