C24H17ClF5NO4 — CID 158580424
3-[2-[2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 158580424) has the molecular formula C24H17ClF5NO4 and a molecular weight of 513.85 g/mol. Its IUPAC name is 3-[2-[2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | 3-[2-[2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 158580424 |
| Molecular Formula | C24H17ClF5NO4 |
| Molecular Weight | 513.85 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 3-[2-[2-(4-chloro-2-methoxyphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | COc1cc(Cl)ccc1Oc1cc(C(F)(F)C(F)(F)F)ccc1C(=O)Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C24H17ClF5NO4/c1-34-21-12-16(25)6-8-19(21)35-20-11-15(23(26,27)24(28,29)30)5-7-17(20)18(32)10-13-3-2-4-14(9-13)22(31)33/h2-9,11-12H,10H2,1H3,(H2,31,33) |
| InChIKey | HTENAAUXTWIMLS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.85 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|