C23H15F6NO3 — CID 161071810
3-[2-[2-(4-fluorophenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 161071810) has the molecular formula C23H15F6NO3 and a molecular weight of 467.37 g/mol. Its IUPAC name is 3-[2-[2-(4-fluorophenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | 3-[2-[2-(4-fluorophenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 161071810 |
| Molecular Formula | C23H15F6NO3 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 3-[2-[2-(4-fluorophenoxy)-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | NC(=O)c1cccc(CC(=O)c2ccc(C(F)(F)C(F)(F)F)cc2Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H15F6NO3/c24-16-5-7-17(8-6-16)33-20-12-15(22(25,26)23(27,28)29)4-9-18(20)19(31)11-13-2-1-3-14(10-13)21(30)32/h1-10,12H,11H2,(H2,30,32) |
| InChIKey | UETIZHUFCJLVTR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|