C17H17ClO3 — CID 39433553
1-(3-chlorophenyl)-3-(3,4-dimethoxyphenyl)propan-2-one (PubChem CID 39433553) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3,4-dimethoxyphenyl)propan-2-one.
| Compound Name | 1-(3-chlorophenyl)-3-(3,4-dimethoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 39433553 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3,4-dimethoxyphenyl)propan-2-one |
| SMILES | COc1ccc(CC(=O)Cc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C17H17ClO3/c1-20-16-7-6-13(11-17(16)21-2)10-15(19)9-12-4-3-5-14(18)8-12/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | JEMFWCWZEYCOJH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |