C28H20F6N2O4S — CID 87097833
N-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 87097833) has the molecular formula C28H20F6N2O4S and a molecular weight of 594.53 g/mol. Its IUPAC name is N-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 87097833 |
| Molecular Formula | C28H20F6N2O4S |
| Molecular Weight | 594.53 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | N-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)Nc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H20F6N2O4S/c1-40-25-11-10-23(41(35,38)39)15-24(25)26(37)36-22-13-18(16-2-6-20(7-3-16)27(29,30)31)12-19(14-22)17-4-8-21(9-5-17)28(32,33)34/h2-15H,1H3,(H,36,37)(H2,35,38,39) |
| InChIKey | FRXVWWOBVIYTEY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.53 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |