C15H14FN3O5S — CID 7964817
3-[[(4-fluorobenzoyl)amino]carbamoyl]-4-methoxybenzenesulfonamide (PubChem CID 7964817) has the molecular formula C15H14FN3O5S and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-[[(4-fluorobenzoyl)amino]carbamoyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-[[(4-fluorobenzoyl)amino]carbamoyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 7964817 |
| Molecular Formula | C15H14FN3O5S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 3-[[(4-fluorobenzoyl)amino]carbamoyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FN3O5S/c1-24-13-7-6-11(25(17,22)23)8-12(13)15(21)19-18-14(20)9-2-4-10(16)5-3-9/h2-8H,1H3,(H,18,20)(H,19,21)(H2,17,22,23) |
| InChIKey | BYWCPUMMWYIDNA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|