C13H6ClF4N2O3- — CID 175125142
2-(2-chloro-4-fluorophenoxy)-N-oxido-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 175125142) has the molecular formula C13H6ClF4N2O3- and a molecular weight of 349.65 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-oxido-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-oxido-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175125142 |
| Molecular Formula | C13H6ClF4N2O3- |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-oxido-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(N[O-])c1cc(C(F)(F)F)cnc1Oc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H6ClF4N2O3/c14-9-4-7(15)1-2-10(9)23-12-8(11(21)20-22)3-6(5-19-12)13(16,17)18/h1-5H,(H-,20,21,22)/q-1 |
| InChIKey | LEDDMMBYLSUDJA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|