C14H10F4N2O2 — CID 175967839
2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 175967839) has the molecular formula C14H10F4N2O2 and a molecular weight of 314.24 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175967839 |
| Molecular Formula | C14H10F4N2O2 |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(F)ccc1Oc1ncc(C(F)(F)F)cc1C(N)=O |
| InChI | InChI=1S/C14H10F4N2O2/c1-7-4-9(15)2-3-11(7)22-13-10(12(19)21)5-8(6-20-13)14(16,17)18/h2-6H,1H3,(H2,19,21) |
| InChIKey | GKUIQUKPOKLNQP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |