C14H10BrF4NO — CID 169249031
3-bromo-2-(4-fluoro-2-methylphenoxy)-4-methyl-5-(trifluoromethyl)pyridine (PubChem CID 169249031) has the molecular formula C14H10BrF4NO and a molecular weight of 364.14 g/mol. Its IUPAC name is 3-bromo-2-(4-fluoro-2-methylphenoxy)-4-methyl-5-(trifluoromethyl)pyridine.
| Compound Name | 3-bromo-2-(4-fluoro-2-methylphenoxy)-4-methyl-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 169249031 |
| Molecular Formula | C14H10BrF4NO |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 3-bromo-2-(4-fluoro-2-methylphenoxy)-4-methyl-5-(trifluoromethyl)pyridine |
| SMILES | Cc1cc(F)ccc1Oc1ncc(C(F)(F)F)c(C)c1Br |
| InChI | InChI=1S/C14H10BrF4NO/c1-7-5-9(16)3-4-11(7)21-13-12(15)8(2)10(6-20-13)14(17,18)19/h3-6H,1-2H3 |
| InChIKey | ZIAKHZKODGWFJB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |