C18H12F4N4O3 — CID 167199270
3-(4-fluoro-2-methylphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-(trifluoromethyl)pyridazine-4-carboxamide (PubChem CID 167199270) has the molecular formula C18H12F4N4O3 and a molecular weight of 408.31 g/mol. Its IUPAC name is 3-(4-fluoro-2-methylphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-(trifluoromethyl)pyridazine-4-carboxamide.
| Compound Name | 3-(4-fluoro-2-methylphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-(trifluoromethyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 167199270 |
| Molecular Formula | C18H12F4N4O3 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 3-(4-fluoro-2-methylphenoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-(trifluoromethyl)pyridazine-4-carboxamide |
| SMILES | Cc1cc(F)ccc1Oc1nnc(C(F)(F)F)cc1C(=O)Nc1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C18H12F4N4O3/c1-10-7-11(19)4-5-14(10)29-17-13(8-15(24-25-17)18(20,21)22)16(27)23-12-3-2-6-26(28)9-12/h2-9H,1H3,(H,23,27) |
| InChIKey | YGIIMYSZLUPJNU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|