C20H16ClFN2O3 — CID 170241443
2-chloro-6-(4-fluoro-2-methylphenoxy)-4-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide (PubChem CID 170241443) has the molecular formula C20H16ClFN2O3 and a molecular weight of 386.81 g/mol. Its IUPAC name is 2-chloro-6-(4-fluoro-2-methylphenoxy)-4-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide.
| Compound Name | 2-chloro-6-(4-fluoro-2-methylphenoxy)-4-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide |
|---|---|
| PubChem CID | 170241443 |
| Molecular Formula | C20H16ClFN2O3 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-chloro-6-(4-fluoro-2-methylphenoxy)-4-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide |
| SMILES | Cc1cc(Cl)c(C(=O)Nc2ccc[n+]([O-])c2)c(Oc2ccc(F)cc2C)c1 |
| InChI | InChI=1S/C20H16ClFN2O3/c1-12-8-16(21)19(20(25)23-15-4-3-7-24(26)11-15)18(9-12)27-17-6-5-14(22)10-13(17)2/h3-11H,1-2H3,(H,23,25) |
| InChIKey | DFBIVSYRZBLZML-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|