C20H11ClF7N2O4+ — CID 167320519
5-chloro-2-[4-fluoro-2-(trifluoromethoxy)phenoxy]-N-(1-hydroxypyridin-1-ium-3-yl)-4-(trifluoromethyl)benzamide (PubChem CID 167320519) has the molecular formula C20H11ClF7N2O4+ and a molecular weight of 511.76 g/mol. Its IUPAC name is 5-chloro-2-[4-fluoro-2-(trifluoromethoxy)phenoxy]-N-(1-hydroxypyridin-1-ium-3-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | 5-chloro-2-[4-fluoro-2-(trifluoromethoxy)phenoxy]-N-(1-hydroxypyridin-1-ium-3-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 167320519 |
| Molecular Formula | C20H11ClF7N2O4+ |
| Molecular Weight | 511.76 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 5-chloro-2-[4-fluoro-2-(trifluoromethoxy)phenoxy]-N-(1-hydroxypyridin-1-ium-3-yl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc[n+](O)c1)c1cc(Cl)c(C(F)(F)F)cc1Oc1ccc(F)cc1OC(F)(F)F |
| InChI | InChI=1S/C20H10ClF7N2O4/c21-14-7-12(18(31)29-11-2-1-5-30(32)9-11)16(8-13(14)19(23,24)25)33-15-4-3-10(22)6-17(15)34-20(26,27)28/h1-9H,(H-,29,31,32)/p+1 |
| InChIKey | WYDXATCRKAYZBH-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|