C23H18F4N2O3 — CID 169207661
6-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxy]-2-methyl-N-(1-oxidopyridin-1-ium-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 169207661) has the molecular formula C23H18F4N2O3 and a molecular weight of 446.40 g/mol. Its IUPAC name is 6-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxy]-2-methyl-N-(1-oxidopyridin-1-ium-3-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 6-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxy]-2-methyl-N-(1-oxidopyridin-1-ium-3-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 169207661 |
| Molecular Formula | C23H18F4N2O3 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 6-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxy]-2-methyl-N-(1-oxidopyridin-1-ium-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | Cc1c(C(F)(F)F)ccc(Oc2ccc(F)c3c2CCC3)c1C(=O)Nc1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C23H18F4N2O3/c1-13-17(23(25,26)27)7-9-20(21(13)22(30)28-14-4-3-11-29(31)12-14)32-19-10-8-18(24)15-5-2-6-16(15)19/h3-4,7-12H,2,5-6H2,1H3,(H,28,30) |
| InChIKey | WCQVONZXVOAHTL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|