C23H18F4N2O4 — CID 167320531
4-(cyclopropylmethyl)-2-fluoro-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide (PubChem CID 167320531) has the molecular formula C23H18F4N2O4 and a molecular weight of 462.40 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-2-fluoro-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide.
| Compound Name | 4-(cyclopropylmethyl)-2-fluoro-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
|---|---|
| PubChem CID | 167320531 |
| Molecular Formula | C23H18F4N2O4 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 4-(cyclopropylmethyl)-2-fluoro-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
| SMILES | O=C(Nc1ccc[n+]([O-])c1)c1c(F)cc(CC2CC2)cc1Oc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H18F4N2O4/c24-19-11-15(10-14-3-4-14)12-20(21(19)22(30)28-16-2-1-9-29(31)13-16)32-17-5-7-18(8-6-17)33-23(25,26)27/h1-2,5-9,11-14H,3-4,10H2,(H,28,30) |
| InChIKey | ZEAPWKQAOPAKLL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|