C23H19F3N2O4 — CID 170241506
4-cyclopropyl-5-methyl-N-(1-oxidopyridin-1-ium-3-yl)-2-[4-(trifluoromethoxy)phenoxy]benzamide (PubChem CID 170241506) has the molecular formula C23H19F3N2O4 and a molecular weight of 444.41 g/mol. Its IUPAC name is 4-cyclopropyl-5-methyl-N-(1-oxidopyridin-1-ium-3-yl)-2-[4-(trifluoromethoxy)phenoxy]benzamide.
| Compound Name | 4-cyclopropyl-5-methyl-N-(1-oxidopyridin-1-ium-3-yl)-2-[4-(trifluoromethoxy)phenoxy]benzamide |
|---|---|
| PubChem CID | 170241506 |
| Molecular Formula | C23H19F3N2O4 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-cyclopropyl-5-methyl-N-(1-oxidopyridin-1-ium-3-yl)-2-[4-(trifluoromethoxy)phenoxy]benzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc[n+]([O-])c2)c(Oc2ccc(OC(F)(F)F)cc2)cc1C1CC1 |
| InChI | InChI=1S/C23H19F3N2O4/c1-14-11-20(22(29)27-16-3-2-10-28(30)13-16)21(12-19(14)15-4-5-15)31-17-6-8-18(9-7-17)32-23(24,25)26/h2-3,6-13,15H,4-5H2,1H3,(H,27,29) |
| InChIKey | DWRZWNAMRBJSIB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|