C26H25F4N3O6 — CID 170241471
2-fluoro-3-methyl-4-(2-morpholin-4-ylethoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide (PubChem CID 170241471) has the molecular formula C26H25F4N3O6 and a molecular weight of 551.49 g/mol. Its IUPAC name is 2-fluoro-3-methyl-4-(2-morpholin-4-ylethoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide.
| Compound Name | 2-fluoro-3-methyl-4-(2-morpholin-4-ylethoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
|---|---|
| PubChem CID | 170241471 |
| Molecular Formula | C26H25F4N3O6 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 2-fluoro-3-methyl-4-(2-morpholin-4-ylethoxy)-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
| SMILES | Cc1c(OCCN2CCOCC2)cc(Oc2ccc(OC(F)(F)F)cc2)c(C(=O)Nc2ccc[n+]([O-])c2)c1F |
| InChI | InChI=1S/C26H25F4N3O6/c1-17-21(37-14-11-32-9-12-36-13-10-32)15-22(38-19-4-6-20(7-5-19)39-26(28,29)30)23(24(17)27)25(34)31-18-3-2-8-33(35)16-18/h2-8,15-16H,9-14H2,1H3,(H,31,34) |
| InChIKey | ZFQNDTLUCCGSFB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|