C20H12F7N2O5+ — CID 170242253
2-fluoro-N-(1-hydroxypyridin-1-ium-4-yl)-4-(trifluoromethoxy)-6-[4-(trifluoromethoxy)phenoxy]benzamide (PubChem CID 170242253) has the molecular formula C20H12F7N2O5+ and a molecular weight of 493.31 g/mol. Its IUPAC name is 2-fluoro-N-(1-hydroxypyridin-1-ium-4-yl)-4-(trifluoromethoxy)-6-[4-(trifluoromethoxy)phenoxy]benzamide.
| Compound Name | 2-fluoro-N-(1-hydroxypyridin-1-ium-4-yl)-4-(trifluoromethoxy)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
|---|---|
| PubChem CID | 170242253 |
| Molecular Formula | C20H12F7N2O5+ |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-fluoro-N-(1-hydroxypyridin-1-ium-4-yl)-4-(trifluoromethoxy)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
| SMILES | O=C(Nc1cc[n+](O)cc1)c1c(F)cc(OC(F)(F)F)cc1Oc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H11F7N2O5/c21-15-9-14(34-20(25,26)27)10-16(17(15)18(30)28-11-5-7-29(31)8-6-11)32-12-1-3-13(4-2-12)33-19(22,23)24/h1-10,31H/p+1 |
| InChIKey | VFSFPMFFAIYFGW-UHFFFAOYSA-O |
| XLogP | 5.19 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|