C24H23F4N3O5 — CID 170241466
4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide (PubChem CID 170241466) has the molecular formula C24H23F4N3O5 and a molecular weight of 509.46 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
|---|---|
| PubChem CID | 170241466 |
| Molecular Formula | C24H23F4N3O5 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
| SMILES | Cc1c(OCCN(C)C)cc(Oc2ccc(OC(F)(F)F)cc2)c(C(=O)Nc2ccc[n+]([O-])c2)c1F |
| InChI | InChI=1S/C24H23F4N3O5/c1-15-19(34-12-11-30(2)3)13-20(35-17-6-8-18(9-7-17)36-24(26,27)28)21(22(15)25)23(32)29-16-5-4-10-31(33)14-16/h4-10,13-14H,11-12H2,1-3H3,(H,29,32) |
| InChIKey | RCEVLDRQVZYKCO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|